11CH/J2

 Mole calculations for Tuesday 19th Jan
Number of moles of a substance =
mass of substance in grams
relative atomic or formula mass

Concentration of solution, mol dm-3 =
number of moles of solute
volume of solution in dm3
Relative atomic masses: H = 1, C = 12, O = 16, Na = 23, Mg = 24, Ca = 40, Br = 80, Ag = 108, Au = 197
1    The number of moles of atoms in 12g of carbon and 108g of silver are the same. Explain this statement.
2    A pure gold wedding ring weighs 4g. How many moles of gold atoms are there in the ring?
3    The ingredients label on a packet of salted crisps says that it contains 0.23g of sodium. How many moles of sodium ions does this represent?
4    What is the mass of 2 moles of calcium carbonate?
5    A 0.75 dm3 bottle of ginger beer contains 14.1g of sucrose, C12H22O11.
a    What is the relative formula mass of the sucrose?
b    How many moles of sucrose are in the ginger beer?
c    What is the concentration of the sucrose in the ginger beer in mol dm–?
Extra challenge
6    A sample of magnesium bromide (MgBr2) weighs 46g. How many moles of magnesium ions and bromide ions are in the sample?


For tuesday 15th

The concentration of a solution is the mass of a solute, in grams, dissolved in 1 dm3 of a solution. The units of concentration are grams per decimetre cubed, g dm–3. The formula is shown below.

Concentration (g dm–3) =            mass of solute (g)      
                                               volume of solution (dm3)

Remember that 1 dm3 is the same volume as 1 l and 1000 cm3.
Try these questions. Show all your working.
1    A sample of sea water with a volume of 2 dm3 contains 60 g of salt dissolved in it. What is the concentration of salt in the sea water?


2    A bottle of ginger beer contains 28 g of sugar in a 0.25 dm3 portion. What is the concentration of sugar in the ginger beer?


3    The laboratory technician made up some limewater for use in chemistry experiments. She dissolved 15 g of calcium hydroxide in water to make up 2 l of solution. What is the concentration of the limewater?


4    Kyle dissolved a cube of sugar with a mass of 3 g in a 100 cm3 cup of coffee. What is the concentration of sugar in Kyle’s coffee?


5    A 1 l bottle of mineral water contains 28 mg of calcium. What is the concentration of calcium
in g dm–3?



6    An Olympic-sized swimming pool has a volume of 2.5 × 106 dm3. 10 kg of chlorine is needed to disinfect the pool. What is the concentration of chlorine in the water in g dm–3?




















Homework for tuesday 3rd november:
For each substance below:
·         find the molecular formula using reference books or the Internet
·         if the relative formula mass is given, show how you can prove this
·         give a common use for the substance.


1   aspirin
2   citric acid
3   ethanoic acid
4   ethanol
5   paracetamol
6   phosphoric acid
7   potassium nitrate
8   trinitrotoluene (TNT)


Present your results in a table.
Extra challenge
9     The formula for a compound X is CH3(CH2)7CH=CH(CH2)7CO2H.
a     Work out the molecular formula of this compound.
b     Calculate the relative formula mass of the compound.
c     Deduce the empirical formula of the compound.
d     Find out the name of the compound.

e     Explain why this compound has been described as ‘the smell of death’.


Make a c2.1, c2.2, c2.3, c2.4 revision poster.

Incude all detail you can! make it as detailed as possible, you will need this for your revision in a few months time! For Tuesday 22nd September :)

CUS

Write a page research on the subject of "How does the chemical industry minimise waste and make a profit?"
use examples, processes and ideas. for Next Tuesday