11CH/R


Mole calculations for Monday 18th Jan
Number of moles of a substance =
mass of substance in grams
relative atomic or formula mass

Concentration of solution, mol dm-3 =
number of moles of solute
volume of solution in dm3
Relative atomic masses: H = 1, C = 12, O = 16, Na = 23, Mg = 24, Ca = 40, Br = 80, Ag = 108, Au = 197
1    The number of moles of atoms in 12g of carbon and 108g of silver are the same. Explain this statement.
2    A pure gold wedding ring weighs 4g. How many moles of gold atoms are there in the ring?
3    The ingredients label on a packet of salted crisps says that it contains 0.23g of sodium. How many moles of sodium ions does this represent?
4    What is the mass of 2 moles of calcium carbonate?
5    A 0.75 dm3 bottle of ginger beer contains 14.1g of sucrose, C12H22O11.
a    What is the relative formula mass of the sucrose?
b    How many moles of sucrose are in the ginger beer?
c    What is the concentration of the sucrose in the ginger beer in mol dm–?
Extra challenge
6    A sample of magnesium bromide (MgBr2) weighs 46g. How many moles of magnesium ions and bromide ions are in the sample?





What is a catalyst and how does it work?
Add a diagram to support your answer.
for Monday 21/09
CUS



Homework for Monday 2nd November:
For each substance below:
·         find the molecular formula using reference books or the Internet
·         if the relative formula mass is given, show how you can prove this
·         give a common use for the substance.


1   aspirin
2   citric acid
3   ethanoic acid
4   ethanol
5   paracetamol
6   phosphoric acid
7   potassium nitrate
8   trinitrotoluene (TNT)


Present your results in a table.
Extra challenge
9     The formula for a compound X is CH3(CH2)7CH=CH(CH2)7CO2H.
a     Work out the molecular formula of this compound.
b     Calculate the relative formula mass of the compound.
c     Deduce the empirical formula of the compound.
d     Find out the name of the compound.

e     Explain why this compound has been described as ‘the smell of death’.